C17H15FO — CID 132850440
4-fluoro-1,3-diphenylpent-1-yn-3-ol (PubChem CID 132850440) has the molecular formula C17H15FO and a molecular weight of 254.30 g/mol. Its IUPAC name is 4-fluoro-1,3-diphenylpent-1-yn-3-ol.
| Compound Name | 4-fluoro-1,3-diphenylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 132850440 |
| Molecular Formula | C17H15FO |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4-fluoro-1,3-diphenylpent-1-yn-3-ol |
| SMILES | CC(F)C(O)(C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H15FO/c1-14(18)17(19,16-10-6-3-7-11-16)13-12-15-8-4-2-5-9-15/h2-11,14,19H,1H3 |
| InChIKey | XGDYUEXLCOMXMX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|