C19H18O3 — CID 102106699
3-hydroxy-2,2-dimethyl-3,5-diphenylpent-4-ynoic acid (PubChem CID 102106699) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyl-3,5-diphenylpent-4-ynoic acid.
| Compound Name | 3-hydroxy-2,2-dimethyl-3,5-diphenylpent-4-ynoic acid |
|---|---|
| PubChem CID | 102106699 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 3-hydroxy-2,2-dimethyl-3,5-diphenylpent-4-ynoic acid |
| SMILES | CC(C)(C(=O)O)C(O)(C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18O3/c1-18(2,17(20)21)19(22,16-11-7-4-8-12-16)14-13-15-9-5-3-6-10-15/h3-12,22H,1-2H3,(H,20,21) |
| InChIKey | LOVDCOVUUGQRDP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|