C31H29NO3S — CID 135072152
N-(3-hydroxy-1,3,5-triphenylpent-4-yn-2-yl)-N,4-dimethylbenzenesulfonamide (PubChem CID 135072152) has the molecular formula C31H29NO3S and a molecular weight of 495.64 g/mol. Its IUPAC name is N-(3-hydroxy-1,3,5-triphenylpent-4-yn-2-yl)-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-(3-hydroxy-1,3,5-triphenylpent-4-yn-2-yl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 135072152 |
| Molecular Formula | C31H29NO3S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-(3-hydroxy-1,3,5-triphenylpent-4-yn-2-yl)-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C(Cc2ccccc2)C(O)(C#Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H29NO3S/c1-25-18-20-29(21-19-25)36(34,35)32(2)30(24-27-14-8-4-9-15-27)31(33,28-16-10-5-11-17-28)23-22-26-12-6-3-7-13-26/h3-21,30,33H,24H2,1-2H3 |
| InChIKey | UTDHIUVCGGFMRP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|