C18H18O — CID 163297469
(2S)-2-ethyl-2,4-diphenylbut-3-yn-1-ol (PubChem CID 163297469) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is (2S)-2-ethyl-2,4-diphenylbut-3-yn-1-ol.
| Compound Name | (2S)-2-ethyl-2,4-diphenylbut-3-yn-1-ol |
|---|---|
| PubChem CID | 163297469 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (2S)-2-ethyl-2,4-diphenylbut-3-yn-1-ol |
| SMILES | CC[C@](C#Cc1ccccc1)(CO)c1ccccc1 |
| InChI | InChI=1S/C18H18O/c1-2-18(15-19,17-11-7-4-8-12-17)14-13-16-9-5-3-6-10-16/h3-12,19H,2,15H2,1H3/t18-/m0/s1 |
| InChIKey | FAGFYOWRJWMFEP-SFHVURJKSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|