C29H36N4 — CID 4125324
4-phenyl-N,N'-bis(2,4,6-trimethylphenyl)piperazine-1-carboximidamide (PubChem CID 4125324) has the molecular formula C29H36N4 and a molecular weight of 440.64 g/mol. Its IUPAC name is 4-phenyl-N,N'-bis(2,4,6-trimethylphenyl)piperazine-1-carboximidamide.
| Compound Name | 4-phenyl-N,N'-bis(2,4,6-trimethylphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 4125324 |
| Molecular Formula | C29H36N4 |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 4-phenyl-N,N'-bis(2,4,6-trimethylphenyl)piperazine-1-carboximidamide |
| SMILES | Cc1cc(C)c(/N=C(/Nc2c(C)cc(C)cc2C)N2CCN(c3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C29H36N4/c1-20-16-22(3)27(23(4)17-20)30-29(31-28-24(5)18-21(2)19-25(28)6)33-14-12-32(13-15-33)26-10-8-7-9-11-26/h7-11,16-19H,12-15H2,1-6H3,(H,30,31) |
| InChIKey | NOYDAQORVUWRCV-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|