C12H18N2O3S — CID 14399776
methyl N'-methylsulfonyl-N-(2,4,6-trimethylphenyl)carbamimidate (PubChem CID 14399776) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is methyl N'-methylsulfonyl-N-(2,4,6-trimethylphenyl)carbamimidate.
| Compound Name | methyl N'-methylsulfonyl-N-(2,4,6-trimethylphenyl)carbamimidate |
|---|---|
| PubChem CID | 14399776 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | methyl N'-methylsulfonyl-N-(2,4,6-trimethylphenyl)carbamimidate |
| SMILES | CO/C(=N\S(C)(=O)=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C12H18N2O3S/c1-8-6-9(2)11(10(3)7-8)13-12(17-4)14-18(5,15)16/h6-7H,1-5H3,(H,13,14) |
| InChIKey | ZZFXVFDNOADZNL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|