C24H32Cl2FeN2O3 — CID 22968361
dichloroiron;2-methoxy-2-[1-methoxy-2-(2,4,6-trimethylphenyl)iminoethoxy]-N-(2,4,6-trimethylphenyl)ethanimine (PubChem CID 22968361) has the molecular formula C24H32Cl2FeN2O3 and a molecular weight of 523.28 g/mol. Its IUPAC name is dichloroiron;2-methoxy-2-[1-methoxy-2-(2,4,6-trimethylphenyl)iminoethoxy]-N-(2,4,6-trimethylphenyl)ethanimine.
| Compound Name | dichloroiron;2-methoxy-2-[1-methoxy-2-(2,4,6-trimethylphenyl)iminoethoxy]-N-(2,4,6-trimethylphenyl)ethanimine |
|---|---|
| PubChem CID | 22968361 |
| Molecular Formula | C24H32Cl2FeN2O3 |
| Molecular Weight | 523.28 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | dichloroiron;2-methoxy-2-[1-methoxy-2-(2,4,6-trimethylphenyl)iminoethoxy]-N-(2,4,6-trimethylphenyl)ethanimine |
| SMILES | COC(/C=N/c1c(C)cc(C)cc1C)OC(/C=N/c1c(C)cc(C)cc1C)OC.Cl[Fe]Cl |
| InChI | InChI=1S/C24H32N2O3.2ClH.Fe/c1-15-9-17(3)23(18(4)10-15)25-13-21(27-7)29-22(28-8)14-26-24-19(5)11-16(2)12-20(24)6;;;/h9-14,21-22H,1-8H3;2*1H;/q;;;+2/p-2/b25-13+,26-14+;;; |
| InChIKey | OFFGOMFWFLEZOY-CWPMVNKHSA-L |
| XLogP | 6.98 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.28 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|