C22H22P2 — CID 177438065
diphenyl-[(2,4,6-trimethylphenyl)phosphanylidenemethyl]phosphane (PubChem CID 177438065) has the molecular formula C22H22P2 and a molecular weight of 348.37 g/mol. Its IUPAC name is diphenyl-[(2,4,6-trimethylphenyl)phosphanylidenemethyl]phosphane.
| Compound Name | diphenyl-[(2,4,6-trimethylphenyl)phosphanylidenemethyl]phosphane |
|---|---|
| PubChem CID | 177438065 |
| Molecular Formula | C22H22P2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | diphenyl-[(2,4,6-trimethylphenyl)phosphanylidenemethyl]phosphane |
| SMILES | Cc1cc(C)c(/P=C/P(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H22P2/c1-17-14-18(2)22(19(3)15-17)23-16-24(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-16H,1-3H3 |
| InChIKey | NBBFLSYLKKLITR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|