C25H29OP — CID 132512078
bis(2,4,6-trimethylphenyl)phosphanyl-phenylmethanol (PubChem CID 132512078) has the molecular formula C25H29OP and a molecular weight of 376.48 g/mol. Its IUPAC name is bis(2,4,6-trimethylphenyl)phosphanyl-phenylmethanol.
| Compound Name | bis(2,4,6-trimethylphenyl)phosphanyl-phenylmethanol |
|---|---|
| PubChem CID | 132512078 |
| Molecular Formula | C25H29OP |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | bis(2,4,6-trimethylphenyl)phosphanyl-phenylmethanol |
| SMILES | Cc1cc(C)c(P(c2c(C)cc(C)cc2C)C(O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C25H29OP/c1-16-12-18(3)23(19(4)13-16)27(25(26)22-10-8-7-9-11-22)24-20(5)14-17(2)15-21(24)6/h7-15,25-26H,1-6H3 |
| InChIKey | RLCICODJHZPXJI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|