C22H22ClP — CID 13256137
benzhydryl-chloro-(2,4,6-trimethylphenyl)phosphane (PubChem CID 13256137) has the molecular formula C22H22ClP and a molecular weight of 352.85 g/mol. Its IUPAC name is benzhydryl-chloro-(2,4,6-trimethylphenyl)phosphane.
| Compound Name | benzhydryl-chloro-(2,4,6-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 13256137 |
| Molecular Formula | C22H22ClP |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | benzhydryl-chloro-(2,4,6-trimethylphenyl)phosphane |
| SMILES | Cc1cc(C)c(P(Cl)C(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H22ClP/c1-16-14-17(2)21(18(3)15-16)24(23)22(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15,22H,1-3H3 |
| InChIKey | BMSQTXZVVNMKSN-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|