C19H15Cl2NO2 — CID 3098706
1-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(4-ethoxyphenyl)methanimine (PubChem CID 3098706) has the molecular formula C19H15Cl2NO2 and a molecular weight of 360.24 g/mol. Its IUPAC name is 1-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(4-ethoxyphenyl)methanimine.
| Compound Name | 1-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(4-ethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 3098706 |
| Molecular Formula | C19H15Cl2NO2 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 1-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(4-ethoxyphenyl)methanimine |
| SMILES | CCOc1ccc(/N=C/c2ccc(-c3ccc(Cl)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C19H15Cl2NO2/c1-2-23-15-6-4-14(5-7-15)22-12-16-8-10-19(24-16)17-9-3-13(20)11-18(17)21/h3-12H,2H2,1H3/b22-12+ |
| InChIKey | QIOKHDPULBPMQQ-WSDLNYQXSA-N |
| XLogP | 6.40 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|