C26H21Cl2N3O2S — CID 133156241
5-[5-(2,4-dichlorophenyl)furan-2-yl]-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156241) has the molecular formula C26H21Cl2N3O2S and a molecular weight of 510.45 g/mol. Its IUPAC name is 5-[5-(2,4-dichlorophenyl)furan-2-yl]-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(2,4-dichlorophenyl)furan-2-yl]-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156241 |
| Molecular Formula | C26H21Cl2N3O2S |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | 5-[5-(2,4-dichlorophenyl)furan-2-yl]-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCOc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(-c3ccc(Cl)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C26H21Cl2N3O2S/c1-2-32-18-9-7-17(8-10-18)31-25(24(30-26(31)34)21-5-3-4-14-29-21)23-13-12-22(33-23)19-11-6-16(27)15-20(19)28/h3-15,24-25H,2H2,1H3,(H,30,34) |
| InChIKey | VNHKMJMLXDXQBZ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|