C32H33ClN4O2S — CID 133241821
1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133241821) has the molecular formula C32H33ClN4O2S and a molecular weight of 573.16 g/mol. Its IUPAC name is 1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133241821 |
| Molecular Formula | C32H33ClN4O2S |
| Molecular Weight | 573.16 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | 1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCOc1ccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3c3ccc(N4CCC(C)CC4)c(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C32H33ClN4O2S/c1-3-38-24-10-7-22(8-11-24)28-13-14-29(39-28)31-30(26-6-4-5-17-34-26)35-32(40)37(31)23-9-12-27(25(33)20-23)36-18-15-21(2)16-19-36/h4-14,17,20-21,30-31H,3,15-16,18-19H2,1-2H3,(H,35,40) |
| InChIKey | HJLJEJZOZXZKKM-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.16 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|