C31H30BrClN4OS — CID 125080686
(4R,5S)-5-[5-(4-bromophenyl)furan-2-yl]-1-[3-chloro-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125080686) has the molecular formula C31H30BrClN4OS and a molecular weight of 622.03 g/mol. Its IUPAC name is (4R,5S)-5-[5-(4-bromophenyl)furan-2-yl]-1-[3-chloro-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-5-[5-(4-bromophenyl)furan-2-yl]-1-[3-chloro-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125080686 |
| Molecular Formula | C31H30BrClN4OS |
| Molecular Weight | 622.03 g/mol |
| Exact Mass | 620.10 |
| IUPAC Name | (4R,5S)-5-[5-(4-bromophenyl)furan-2-yl]-1-[3-chloro-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | C[C@@H]1C[C@H](C)CN(c2ccc(N3C(=S)N[C@@H](c4ccccn4)[C@H]3c3ccc(-c4ccc(Br)cc4)o3)cc2Cl)C1 |
| InChI | InChI=1S/C31H30BrClN4OS/c1-19-15-20(2)18-36(17-19)26-11-10-23(16-24(26)33)37-30(29(35-31(37)39)25-5-3-4-14-34-25)28-13-12-27(38-28)21-6-8-22(32)9-7-21/h3-14,16,19-20,29-30H,15,17-18H2,1-2H3,(H,35,39)/t19-,20+,29-,30+/m0/s1 |
| InChIKey | UAJZOVDPGQEUFC-NELHGCTQSA-N |
| XLogP | 8.42 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.03 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|