C24H17Br2N3OS — CID 133182786
1-(4-bromophenyl)-5-[5-(4-bromophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133182786) has the molecular formula C24H17Br2N3OS and a molecular weight of 555.30 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5-[5-(4-bromophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-bromophenyl)-5-[5-(4-bromophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133182786 |
| Molecular Formula | C24H17Br2N3OS |
| Molecular Weight | 555.30 g/mol |
| Exact Mass | 552.95 |
| IUPAC Name | 1-(4-bromophenyl)-5-[5-(4-bromophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2ccc(-c3ccc(Br)cc3)o2)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H17Br2N3OS/c25-16-6-4-15(5-7-16)20-12-13-21(30-20)23-22(19-3-1-2-14-27-19)28-24(31)29(23)18-10-8-17(26)9-11-18/h1-14,22-23H,(H,28,31) |
| InChIKey | RLWZRHDSBQDCTP-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.30 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|