C31H31ClN4OS2 — CID 125079322
(4S,5R)-1-[3-chloro-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125079322) has the molecular formula C31H31ClN4OS2 and a molecular weight of 575.20 g/mol. Its IUPAC name is (4S,5R)-1-[3-chloro-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-1-[3-chloro-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125079322 |
| Molecular Formula | C31H31ClN4OS2 |
| Molecular Weight | 575.20 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | (4S,5R)-1-[3-chloro-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | C[C@@H]1C[C@H](C)CN(c2ccc(N3C(=S)N[C@H](c4ccccn4)[C@@H]3c3ccc(Sc4ccccc4)o3)cc2Cl)C1 |
| InChI | InChI=1S/C31H31ClN4OS2/c1-20-16-21(2)19-35(18-20)26-12-11-22(17-24(26)32)36-30(29(34-31(36)38)25-10-6-7-15-33-25)27-13-14-28(37-27)39-23-8-4-3-5-9-23/h3-15,17,20-21,29-30H,16,18-19H2,1-2H3,(H,34,38)/t20-,21+,29-,30+/m1/s1 |
| InChIKey | MIRDEXRYUSPLHF-JMGNVCAQSA-N |
| XLogP | 8.14 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.20 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|