C32H32ClN5O4S — CID 133157620
1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157620) has the molecular formula C32H32ClN5O4S and a molecular weight of 618.16 g/mol. Its IUPAC name is 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157620 |
| Molecular Formula | C32H32ClN5O4S |
| Molecular Weight | 618.16 g/mol |
| Exact Mass | 617.19 |
| IUPAC Name | 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(C2C(c3ccccn3)NC(=S)N2c2ccc(N3CC(C)CC(C)C3)c(Cl)c2)o1 |
| InChI | InChI=1S/C32H32ClN5O4S/c1-19-14-20(2)18-36(17-19)26-10-8-21(15-24(26)33)37-31(30(35-32(37)43)25-6-4-5-13-34-25)28-12-11-27(42-28)23-9-7-22(38(39)40)16-29(23)41-3/h4-13,15-16,19-20,30-31H,14,17-18H2,1-3H3,(H,35,43) |
| InChIKey | HHDGKRXRCXNLAO-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.16 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|