C32H32BrClN4OS — CID 125081091
(4R,5S)-5-[5-(2-bromo-4-methylphenyl)furan-2-yl]-1-[3-chloro-4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]phenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125081091) has the molecular formula C32H32BrClN4OS and a molecular weight of 636.06 g/mol. Its IUPAC name is (4R,5S)-5-[5-(2-bromo-4-methylphenyl)furan-2-yl]-1-[3-chloro-4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]phenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-5-[5-(2-bromo-4-methylphenyl)furan-2-yl]-1-[3-chloro-4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125081091 |
| Molecular Formula | C32H32BrClN4OS |
| Molecular Weight | 636.06 g/mol |
| Exact Mass | 634.12 |
| IUPAC Name | (4R,5S)-5-[5-(2-bromo-4-methylphenyl)furan-2-yl]-1-[3-chloro-4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(-c2ccc([C@@H]3[C@H](c4ccccn4)NC(=S)N3c3ccc(N4C[C@H](C)C[C@@H](C)C4)c(Cl)c3)o2)c(Br)c1 |
| InChI | InChI=1S/C32H32BrClN4OS/c1-19-7-9-23(24(33)15-19)28-11-12-29(39-28)31-30(26-6-4-5-13-35-26)36-32(40)38(31)22-8-10-27(25(34)16-22)37-17-20(2)14-21(3)18-37/h4-13,15-16,20-21,30-31H,14,17-18H2,1-3H3,(H,36,40)/t20-,21-,30+,31-/m1/s1 |
| InChIKey | WIUXRMXETYBFKW-OYFHWARDSA-N |
| XLogP | 8.73 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.06 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|