C31H30Cl2N4OS — CID 100521354
(4S,5R)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100521354) has the molecular formula C31H30Cl2N4OS and a molecular weight of 577.58 g/mol. Its IUPAC name is (4S,5R)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100521354 |
| Molecular Formula | C31H30Cl2N4OS |
| Molecular Weight | 577.58 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | (4S,5R)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(Cl)cc1-c1ccc([C@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(N3CCC(C)CC3)c(Cl)c2)o1 |
| InChI | InChI=1S/C31H30Cl2N4OS/c1-19-12-15-36(16-13-19)26-9-8-22(18-24(26)33)37-30(29(35-31(37)39)25-5-3-4-14-34-25)28-11-10-27(38-28)23-17-21(32)7-6-20(23)2/h3-11,14,17-19,29-30H,12-13,15-16H2,1-2H3,(H,35,39)/t29-,30+/m1/s1 |
| InChIKey | YSTXXNAQELLKPC-IHLOFXLRSA-N |
| XLogP | 8.37 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.58 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|