C24H25ClN4OS — CID 100516239
(4R,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(furan-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100516239) has the molecular formula C24H25ClN4OS and a molecular weight of 453.01 g/mol. Its IUPAC name is (4R,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(furan-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(furan-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100516239 |
| Molecular Formula | C24H25ClN4OS |
| Molecular Weight | 453.01 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (4R,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(furan-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1CCN(c2ccc(N3C(=S)N[C@@H](c4ccccn4)[C@H]3c3ccco3)cc2Cl)CC1 |
| InChI | InChI=1S/C24H25ClN4OS/c1-16-9-12-28(13-10-16)20-8-7-17(15-18(20)25)29-23(21-6-4-14-30-21)22(27-24(29)31)19-5-2-3-11-26-19/h2-8,11,14-16,22-23H,9-10,12-13H2,1H3,(H,27,31)/t22-,23+/m0/s1 |
| InChIKey | MNSPFVABDHGEHU-XZOQPEGZSA-N |
| XLogP | 5.74 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.01 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|