C31H28Cl2N4O3S — CID 133241836
4-chloro-3-[5-[3-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid (PubChem CID 133241836) has the molecular formula C31H28Cl2N4O3S and a molecular weight of 607.56 g/mol. Its IUPAC name is 4-chloro-3-[5-[3-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[3-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 133241836 |
| Molecular Formula | C31H28Cl2N4O3S |
| Molecular Weight | 607.56 g/mol |
| Exact Mass | 606.13 |
| IUPAC Name | 4-chloro-3-[5-[3-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
| SMILES | CC1CCN(c2ccc(N3C(=S)NC(c4ccccn4)C3c3ccc(-c4cc(C(=O)O)ccc4Cl)o3)cc2Cl)CC1 |
| InChI | InChI=1S/C31H28Cl2N4O3S/c1-18-11-14-36(15-12-18)25-8-6-20(17-23(25)33)37-29(28(35-31(37)41)24-4-2-3-13-34-24)27-10-9-26(40-27)21-16-19(30(38)39)5-7-22(21)32/h2-10,13,16-18,28-29H,11-12,14-15H2,1H3,(H,35,41)(H,38,39) |
| InChIKey | VNTIRRWZSBLDOC-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.56 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|