C32H31ClN4O3S — CID 133241854
methyl 4-[5-[3-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate (PubChem CID 133241854) has the molecular formula C32H31ClN4O3S and a molecular weight of 587.15 g/mol. Its IUPAC name is methyl 4-[5-[3-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[3-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 133241854 |
| Molecular Formula | C32H31ClN4O3S |
| Molecular Weight | 587.15 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | methyl 4-[5-[3-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3c3ccc(N4CCC(C)CC4)c(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C32H31ClN4O3S/c1-20-14-17-36(18-15-20)26-11-10-23(19-24(26)33)37-30(29(35-32(37)41)25-5-3-4-16-34-25)28-13-12-27(40-28)21-6-8-22(9-7-21)31(38)39-2/h3-13,16,19-20,29-30H,14-15,17-18H2,1-2H3,(H,35,41) |
| InChIKey | PYQHFFPVXGLQMH-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.15 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|