C27H22BrN3O3S — CID 100510166
methyl 4-[5-[(4S,5R)-3-(4-bromo-3-methylphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate (PubChem CID 100510166) has the molecular formula C27H22BrN3O3S and a molecular weight of 548.46 g/mol. Its IUPAC name is methyl 4-[5-[(4S,5R)-3-(4-bromo-3-methylphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[(4S,5R)-3-(4-bromo-3-methylphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 100510166 |
| Molecular Formula | C27H22BrN3O3S |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | methyl 4-[5-[(4S,5R)-3-(4-bromo-3-methylphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc([C@@H]3[C@H](c4ccccn4)NC(=S)N3c3ccc(Br)c(C)c3)o2)cc1 |
| InChI | InChI=1S/C27H22BrN3O3S/c1-16-15-19(10-11-20(16)28)31-25(24(30-27(31)35)21-5-3-4-14-29-21)23-13-12-22(34-23)17-6-8-18(9-7-17)26(32)33-2/h3-15,24-25H,1-2H3,(H,30,35)/t24-,25+/m0/s1 |
| InChIKey | TUBNEMGHMGSOJP-LOSJGSFVSA-N |
| XLogP | 6.38 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|