C26H20BrN3O3S — CID 100508980
2-[5-[(4S,5R)-3-(4-bromo-3-methylphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid (PubChem CID 100508980) has the molecular formula C26H20BrN3O3S and a molecular weight of 534.44 g/mol. Its IUPAC name is 2-[5-[(4S,5R)-3-(4-bromo-3-methylphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[(4S,5R)-3-(4-bromo-3-methylphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 100508980 |
| Molecular Formula | C26H20BrN3O3S |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 533.04 |
| IUPAC Name | 2-[5-[(4S,5R)-3-(4-bromo-3-methylphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
| SMILES | Cc1cc(N2C(=S)N[C@@H](c3ccccn3)[C@H]2c2ccc(-c3ccccc3C(=O)O)o2)ccc1Br |
| InChI | InChI=1S/C26H20BrN3O3S/c1-15-14-16(9-10-19(15)27)30-24(23(29-26(30)34)20-8-4-5-13-28-20)22-12-11-21(33-22)17-6-2-3-7-18(17)25(31)32/h2-14,23-24H,1H3,(H,29,34)(H,31,32)/t23-,24+/m0/s1 |
| InChIKey | JTOUKLHKTPUCAP-BJKOFHAPSA-N |
| XLogP | 6.29 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|