C25H20BrN3OS2 — CID 100508675
(4S,5R)-1-(4-bromo-3-methylphenyl)-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100508675) has the molecular formula C25H20BrN3OS2 and a molecular weight of 522.49 g/mol. Its IUPAC name is (4S,5R)-1-(4-bromo-3-methylphenyl)-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-1-(4-bromo-3-methylphenyl)-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100508675 |
| Molecular Formula | C25H20BrN3OS2 |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 521.02 |
| IUPAC Name | (4S,5R)-1-(4-bromo-3-methylphenyl)-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)N[C@H](c3ccccn3)[C@@H]2c2ccc(Sc3ccccc3)o2)ccc1Br |
| InChI | InChI=1S/C25H20BrN3OS2/c1-16-15-17(10-11-19(16)26)29-24(23(28-25(29)31)20-9-5-6-14-27-20)21-12-13-22(30-21)32-18-7-3-2-4-8-18/h2-15,23-24H,1H3,(H,28,31)/t23-,24+/m1/s1 |
| InChIKey | QMIRBBPFCDHINM-RPWUZVMVSA-N |
| XLogP | 7.07 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|