C25H18Br2FN3OS — CID 100509279
(4S,5S)-5-[5-(4-bromo-2-fluorophenyl)furan-2-yl]-1-(4-bromo-3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100509279) has the molecular formula C25H18Br2FN3OS and a molecular weight of 587.31 g/mol. Its IUPAC name is (4S,5S)-5-[5-(4-bromo-2-fluorophenyl)furan-2-yl]-1-(4-bromo-3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-5-[5-(4-bromo-2-fluorophenyl)furan-2-yl]-1-(4-bromo-3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100509279 |
| Molecular Formula | C25H18Br2FN3OS |
| Molecular Weight | 587.31 g/mol |
| Exact Mass | 584.95 |
| IUPAC Name | (4S,5S)-5-[5-(4-bromo-2-fluorophenyl)furan-2-yl]-1-(4-bromo-3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)N[C@H](c3ccccn3)[C@H]2c2ccc(-c3ccc(Br)cc3F)o2)ccc1Br |
| InChI | InChI=1S/C25H18Br2FN3OS/c1-14-12-16(6-8-18(14)27)31-24(23(30-25(31)33)20-4-2-3-11-29-20)22-10-9-21(32-22)17-7-5-15(26)13-19(17)28/h2-13,23-24H,1H3,(H,30,33)/t23-,24-/m1/s1 |
| InChIKey | BIKRGTIKCOYDED-DNQXCXABSA-N |
| XLogP | 7.49 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.31 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|