C20H17BrFN3O2S — CID 133181999
5-[5-(4-bromo-2-fluorophenyl)furan-2-yl]-1-(2-hydroxyethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133181999) has the molecular formula C20H17BrFN3O2S and a molecular weight of 462.34 g/mol. Its IUPAC name is 5-[5-(4-bromo-2-fluorophenyl)furan-2-yl]-1-(2-hydroxyethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(4-bromo-2-fluorophenyl)furan-2-yl]-1-(2-hydroxyethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133181999 |
| Molecular Formula | C20H17BrFN3O2S |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 5-[5-(4-bromo-2-fluorophenyl)furan-2-yl]-1-(2-hydroxyethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | OCCN1C(=S)NC(c2ccccn2)C1c1ccc(-c2ccc(Br)cc2F)o1 |
| InChI | InChI=1S/C20H17BrFN3O2S/c21-12-4-5-13(14(22)11-12)16-6-7-17(27-16)19-18(15-3-1-2-8-23-15)24-20(28)25(19)9-10-26/h1-8,11,18-19,26H,9-10H2,(H,24,28) |
| InChIKey | KKIIXZXMESFDPA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|