C24H18BrFN4OS — CID 133181841
5-[5-(2-bromo-4-fluorophenyl)furan-2-yl]-4-pyridin-2-yl-1-(pyridin-2-ylmethyl)imidazolidine-2-thione (PubChem CID 133181841) has the molecular formula C24H18BrFN4OS and a molecular weight of 509.40 g/mol. Its IUPAC name is 5-[5-(2-bromo-4-fluorophenyl)furan-2-yl]-4-pyridin-2-yl-1-(pyridin-2-ylmethyl)imidazolidine-2-thione.
| Compound Name | 5-[5-(2-bromo-4-fluorophenyl)furan-2-yl]-4-pyridin-2-yl-1-(pyridin-2-ylmethyl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 133181841 |
| Molecular Formula | C24H18BrFN4OS |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 5-[5-(2-bromo-4-fluorophenyl)furan-2-yl]-4-pyridin-2-yl-1-(pyridin-2-ylmethyl)imidazolidine-2-thione |
| SMILES | Fc1ccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3Cc3ccccn3)o2)c(Br)c1 |
| InChI | InChI=1S/C24H18BrFN4OS/c25-18-13-15(26)7-8-17(18)20-9-10-21(31-20)23-22(19-6-2-4-12-28-19)29-24(32)30(23)14-16-5-1-3-11-27-16/h1-13,22-23H,14H2,(H,29,32) |
| InChIKey | USANTOSMIFCANW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|