C23H21BrFN3OS — CID 100527413
(4R,5S)-5-[5-(2-bromo-4-fluorophenyl)furan-2-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100527413) has the molecular formula C23H21BrFN3OS and a molecular weight of 486.41 g/mol. Its IUPAC name is (4R,5S)-5-[5-(2-bromo-4-fluorophenyl)furan-2-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-5-[5-(2-bromo-4-fluorophenyl)furan-2-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100527413 |
| Molecular Formula | C23H21BrFN3OS |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | (4R,5S)-5-[5-(2-bromo-4-fluorophenyl)furan-2-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Fc1ccc(-c2ccc([C@@H]3[C@H](c4ccccn4)NC(=S)N3C3CCCC3)o2)c(Br)c1 |
| InChI | InChI=1S/C23H21BrFN3OS/c24-17-13-14(25)8-9-16(17)19-10-11-20(29-19)22-21(18-7-3-4-12-26-18)27-23(30)28(22)15-5-1-2-6-15/h3-4,7-13,15,21-22H,1-2,5-6H2,(H,27,30)/t21-,22+/m0/s1 |
| InChIKey | RGPNLAJPACLNSA-FCHUYYIVSA-N |
| XLogP | 6.16 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|