C24H24ClN3OS — CID 100527488
(4R,5S)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100527488) has the molecular formula C24H24ClN3OS and a molecular weight of 438.00 g/mol. Its IUPAC name is (4R,5S)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100527488 |
| Molecular Formula | C24H24ClN3OS |
| Molecular Weight | 438.00 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (4R,5S)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(Cl)cc1-c1ccc([C@@H]2[C@H](c3ccccn3)NC(=S)N2C2CCCC2)o1 |
| InChI | InChI=1S/C24H24ClN3OS/c1-15-9-10-16(25)14-18(15)20-11-12-21(29-20)23-22(19-8-4-5-13-26-19)27-24(30)28(23)17-6-2-3-7-17/h4-5,8-14,17,22-23H,2-3,6-7H2,1H3,(H,27,30)/t22-,23+/m0/s1 |
| InChIKey | DEZAHDDEBBGFQT-XZOQPEGZSA-N |
| XLogP | 6.22 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.00 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|