C23H22N4O3S — CID 100526942
(4S,5S)-1-cyclopentyl-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100526942) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is (4S,5S)-1-cyclopentyl-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-cyclopentyl-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100526942 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (4S,5S)-1-cyclopentyl-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccc([C@@H]2[C@@H](c3ccccn3)NC(=S)N2C2CCCC2)o1 |
| InChI | InChI=1S/C23H22N4O3S/c28-27(29)18-11-4-3-9-16(18)19-12-13-20(30-19)22-21(17-10-5-6-14-24-17)25-23(31)26(22)15-7-1-2-8-15/h3-6,9-15,21-22H,1-2,7-8H2,(H,25,31)/t21-,22-/m1/s1 |
| InChIKey | DPAKPFCXNRDXFQ-FGZHOGPDSA-N |
| XLogP | 5.16 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|