C24H23N3O3S — CID 100527110
4-[5-[(4R,5R)-3-cyclopentyl-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid (PubChem CID 100527110) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is 4-[5-[(4R,5R)-3-cyclopentyl-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[(4R,5R)-3-cyclopentyl-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 100527110 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 4-[5-[(4R,5R)-3-cyclopentyl-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc([C@H]3[C@H](c4ccccn4)NC(=S)N3C3CCCC3)o2)cc1 |
| InChI | InChI=1S/C24H23N3O3S/c28-23(29)16-10-8-15(9-11-16)19-12-13-20(30-19)22-21(18-7-3-4-14-25-18)26-24(31)27(22)17-5-1-2-6-17/h3-4,7-14,17,21-22H,1-2,5-6H2,(H,26,31)(H,28,29)/t21-,22-/m0/s1 |
| InChIKey | MMTIRIULCPAIHH-VXKWHMMOSA-N |
| XLogP | 4.95 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|