C23H21Cl2N3OS — CID 100527211
(4R,5S)-1-cyclopentyl-5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100527211) has the molecular formula C23H21Cl2N3OS and a molecular weight of 458.41 g/mol. Its IUPAC name is (4R,5S)-1-cyclopentyl-5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-cyclopentyl-5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100527211 |
| Molecular Formula | C23H21Cl2N3OS |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | (4R,5S)-1-cyclopentyl-5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1N[C@@H](c2ccccn2)[C@@H](c2ccc(-c3ccc(Cl)c(Cl)c3)o2)N1C1CCCC1 |
| InChI | InChI=1S/C23H21Cl2N3OS/c24-16-9-8-14(13-17(16)25)19-10-11-20(29-19)22-21(18-7-3-4-12-26-18)27-23(30)28(22)15-5-1-2-6-15/h3-4,7-13,15,21-22H,1-2,5-6H2,(H,27,30)/t21-,22+/m0/s1 |
| InChIKey | IASRSWFWTWCZTO-FCHUYYIVSA-N |
| XLogP | 6.56 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|