C24H24FN3OS — CID 133222817
1-cyclohexyl-5-[5-(4-fluorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133222817) has the molecular formula C24H24FN3OS and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-cyclohexyl-5-[5-(4-fluorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-cyclohexyl-5-[5-(4-fluorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133222817 |
| Molecular Formula | C24H24FN3OS |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 1-cyclohexyl-5-[5-(4-fluorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Fc1ccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3C3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C24H24FN3OS/c25-17-11-9-16(10-12-17)20-13-14-21(29-20)23-22(19-8-4-5-15-26-19)27-24(30)28(23)18-6-2-1-3-7-18/h4-5,8-15,18,22-23H,1-3,6-7H2,(H,27,30) |
| InChIKey | FWVPCIHKSWQEJF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|