C22H23FN4OS — CID 133223488
1-[2-(dimethylamino)ethyl]-5-[5-(4-fluorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223488) has the molecular formula C22H23FN4OS and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-5-[5-(4-fluorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[2-(dimethylamino)ethyl]-5-[5-(4-fluorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223488 |
| Molecular Formula | C22H23FN4OS |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-5-[5-(4-fluorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CN(C)CCN1C(=S)NC(c2ccccn2)C1c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C22H23FN4OS/c1-26(2)13-14-27-21(20(25-22(27)29)17-5-3-4-12-24-17)19-11-10-18(28-19)15-6-8-16(23)9-7-15/h3-12,20-21H,13-14H2,1-2H3,(H,25,29) |
| InChIKey | UPQSLZJURPDHBY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|