C27H22ClFN4O2S — CID 133208868
3-[5-[5-(4-chlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-fluorophenyl)propanamide (PubChem CID 133208868) has the molecular formula C27H22ClFN4O2S and a molecular weight of 521.02 g/mol. Its IUPAC name is 3-[5-[5-(4-chlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-fluorophenyl)propanamide.
| Compound Name | 3-[5-[5-(4-chlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 133208868 |
| Molecular Formula | C27H22ClFN4O2S |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 3-[5-[5-(4-chlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-fluorophenyl)propanamide |
| SMILES | O=C(CCN1C(=S)NC(c2ccccn2)C1c1ccc(-c2ccc(Cl)cc2)o1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C27H22ClFN4O2S/c28-18-6-4-17(5-7-18)22-12-13-23(35-22)26-25(21-3-1-2-15-30-21)32-27(36)33(26)16-14-24(34)31-20-10-8-19(29)9-11-20/h1-13,15,25-26H,14,16H2,(H,31,34)(H,32,36) |
| InChIKey | UBDGZPOMBJEUHL-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|