C27H23ClN4O2S — CID 100670011
3-[(4S,5R)-5-[5-(4-chlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide (PubChem CID 100670011) has the molecular formula C27H23ClN4O2S and a molecular weight of 503.03 g/mol. Its IUPAC name is 3-[(4S,5R)-5-[5-(4-chlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide.
| Compound Name | 3-[(4S,5R)-5-[5-(4-chlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 100670011 |
| Molecular Formula | C27H23ClN4O2S |
| Molecular Weight | 503.03 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 3-[(4S,5R)-5-[5-(4-chlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide |
| SMILES | O=C(CCN1C(=S)N[C@H](c2ccccn2)[C@@H]1c1ccc(-c2ccc(Cl)cc2)o1)Nc1ccccc1 |
| InChI | InChI=1S/C27H23ClN4O2S/c28-19-11-9-18(10-12-19)22-13-14-23(34-22)26-25(21-8-4-5-16-29-21)31-27(35)32(26)17-15-24(33)30-20-6-2-1-3-7-20/h1-14,16,25-26H,15,17H2,(H,30,33)(H,31,35)/t25-,26+/m1/s1 |
| InChIKey | KTBCJCGWMWFIHF-FTJBHMTQSA-N |
| XLogP | 6.00 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.03 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|