C28H25ClN4O2S — CID 100670892
3-[(4R,5S)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide (PubChem CID 100670892) has the molecular formula C28H25ClN4O2S and a molecular weight of 517.05 g/mol. Its IUPAC name is 3-[(4R,5S)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide.
| Compound Name | 3-[(4R,5S)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 100670892 |
| Molecular Formula | C28H25ClN4O2S |
| Molecular Weight | 517.05 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 3-[(4R,5S)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide |
| SMILES | Cc1ccc(Cl)cc1-c1ccc([C@@H]2[C@H](c3ccccn3)NC(=S)N2CCC(=O)Nc2ccccc2)o1 |
| InChI | InChI=1S/C28H25ClN4O2S/c1-18-10-11-19(29)17-21(18)23-12-13-24(35-23)27-26(22-9-5-6-15-30-22)32-28(36)33(27)16-14-25(34)31-20-7-3-2-4-8-20/h2-13,15,17,26-27H,14,16H2,1H3,(H,31,34)(H,32,36)/t26-,27+/m0/s1 |
| InChIKey | LDUHISSVSXKEFY-RRPNLBNLSA-N |
| XLogP | 6.30 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.05 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|