C27H22Cl2N4O2S — CID 100670390
3-[(4R,5S)-5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide (PubChem CID 100670390) has the molecular formula C27H22Cl2N4O2S and a molecular weight of 537.47 g/mol. Its IUPAC name is 3-[(4R,5S)-5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide.
| Compound Name | 3-[(4R,5S)-5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 100670390 |
| Molecular Formula | C27H22Cl2N4O2S |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | 3-[(4R,5S)-5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide |
| SMILES | O=C(CCN1C(=S)N[C@@H](c2ccccn2)[C@H]1c1ccc(-c2ccc(Cl)c(Cl)c2)o1)Nc1ccccc1 |
| InChI | InChI=1S/C27H22Cl2N4O2S/c28-19-10-9-17(16-20(19)29)22-11-12-23(35-22)26-25(21-8-4-5-14-30-21)32-27(36)33(26)15-13-24(34)31-18-6-2-1-3-7-18/h1-12,14,16,25-26H,13,15H2,(H,31,34)(H,32,36)/t25-,26+/m0/s1 |
| InChIKey | NOHVARNPGAFONI-IZZNHLLZSA-N |
| XLogP | 6.65 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|