C27H23ClN4O2S2 — CID 133208559
3-[5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide (PubChem CID 133208559) has the molecular formula C27H23ClN4O2S2 and a molecular weight of 535.09 g/mol. Its IUPAC name is 3-[5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide.
| Compound Name | 3-[5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 133208559 |
| Molecular Formula | C27H23ClN4O2S2 |
| Molecular Weight | 535.09 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 3-[5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide |
| SMILES | O=C(CCN1C(=S)NC(c2ccccn2)C1c1ccc(Sc2ccc(Cl)cc2)o1)Nc1ccccc1 |
| InChI | InChI=1S/C27H23ClN4O2S2/c28-18-9-11-20(12-10-18)36-24-14-13-22(34-24)26-25(21-8-4-5-16-29-21)31-27(35)32(26)17-15-23(33)30-19-6-2-1-3-7-19/h1-14,16,25-26H,15,17H2,(H,30,33)(H,31,35) |
| InChIKey | LJZXPGXVRHLJFJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.09 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|