C22H22FN3O2S — CID 133222647
5-[5-(4-fluorophenyl)furan-2-yl]-1-(3-methoxypropyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133222647) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is 5-[5-(4-fluorophenyl)furan-2-yl]-1-(3-methoxypropyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(4-fluorophenyl)furan-2-yl]-1-(3-methoxypropyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133222647 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 5-[5-(4-fluorophenyl)furan-2-yl]-1-(3-methoxypropyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COCCCN1C(=S)NC(c2ccccn2)C1c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C22H22FN3O2S/c1-27-14-4-13-26-21(20(25-22(26)29)17-5-2-3-12-24-17)19-11-10-18(28-19)15-6-8-16(23)9-7-15/h2-3,5-12,20-21H,4,13-14H2,1H3,(H,25,29) |
| InChIKey | TVBCTBTVWQENAC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|