C22H21N3O4S — CID 133155397
4-[5-[3-(3-hydroxypropyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid (PubChem CID 133155397) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is 4-[5-[3-(3-hydroxypropyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[3-(3-hydroxypropyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 133155397 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 4-[5-[3-(3-hydroxypropyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3CCCO)o2)cc1 |
| InChI | InChI=1S/C22H21N3O4S/c26-13-3-12-25-20(19(24-22(25)30)16-4-1-2-11-23-16)18-10-9-17(29-18)14-5-7-15(8-6-14)21(27)28/h1-2,4-11,19-20,26H,3,12-13H2,(H,24,30)(H,27,28) |
| InChIKey | MTXANBLRWVXZCW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|