C26H22N4O2S — CID 100662177
N-phenyl-2-[(4S,5S)-5-(5-phenylfuran-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetamide (PubChem CID 100662177) has the molecular formula C26H22N4O2S and a molecular weight of 454.56 g/mol. Its IUPAC name is N-phenyl-2-[(4S,5S)-5-(5-phenylfuran-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetamide.
| Compound Name | N-phenyl-2-[(4S,5S)-5-(5-phenylfuran-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 100662177 |
| Molecular Formula | C26H22N4O2S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N-phenyl-2-[(4S,5S)-5-(5-phenylfuran-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetamide |
| SMILES | O=C(CN1C(=S)N[C@H](c2ccccn2)[C@H]1c1ccc(-c2ccccc2)o1)Nc1ccccc1 |
| InChI | InChI=1S/C26H22N4O2S/c31-23(28-19-11-5-2-6-12-19)17-30-25(24(29-26(30)33)20-13-7-8-16-27-20)22-15-14-21(32-22)18-9-3-1-4-10-18/h1-16,24-25H,17H2,(H,28,31)(H,29,33)/t24-,25-/m1/s1 |
| InChIKey | ZBRKLKWJGFNIJX-JWQCQUIFSA-N |
| XLogP | 4.95 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|