C27H23BrN4O2S — CID 100663127
2-[(4R,5R)-5-[5-(2-bromo-4-methylphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 100663127) has the molecular formula C27H23BrN4O2S and a molecular weight of 547.48 g/mol. Its IUPAC name is 2-[(4R,5R)-5-[5-(2-bromo-4-methylphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[(4R,5R)-5-[5-(2-bromo-4-methylphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 100663127 |
| Molecular Formula | C27H23BrN4O2S |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | 2-[(4R,5R)-5-[5-(2-bromo-4-methylphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | Cc1ccc(-c2ccc([C@H]3[C@H](c4ccccn4)NC(=S)N3CC(=O)Nc3ccccc3)o2)c(Br)c1 |
| InChI | InChI=1S/C27H23BrN4O2S/c1-17-10-11-19(20(28)15-17)22-12-13-23(34-22)26-25(21-9-5-6-14-29-21)31-27(35)32(26)16-24(33)30-18-7-3-2-4-8-18/h2-15,25-26H,16H2,1H3,(H,30,33)(H,31,35)/t25-,26-/m0/s1 |
| InChIKey | FRVFIXVTDOFKQF-UIOOFZCWSA-N |
| XLogP | 6.02 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|