C27H21ClN4O4S — CID 100663357
3-[5-[(4R,5R)-3-(2-anilino-2-oxoethyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]-4-chlorobenzoic acid (PubChem CID 100663357) has the molecular formula C27H21ClN4O4S and a molecular weight of 533.01 g/mol. Its IUPAC name is 3-[5-[(4R,5R)-3-(2-anilino-2-oxoethyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]-4-chlorobenzoic acid.
| Compound Name | 3-[5-[(4R,5R)-3-(2-anilino-2-oxoethyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 100663357 |
| Molecular Formula | C27H21ClN4O4S |
| Molecular Weight | 533.01 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 3-[5-[(4R,5R)-3-(2-anilino-2-oxoethyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]-4-chlorobenzoic acid |
| SMILES | O=C(CN1C(=S)N[C@@H](c2ccccn2)[C@@H]1c1ccc(-c2cc(C(=O)O)ccc2Cl)o1)Nc1ccccc1 |
| InChI | InChI=1S/C27H21ClN4O4S/c28-19-10-9-16(26(34)35)14-18(19)21-11-12-22(36-21)25-24(20-8-4-5-13-29-20)31-27(37)32(25)15-23(33)30-17-6-2-1-3-7-17/h1-14,24-25H,15H2,(H,30,33)(H,31,37)(H,34,35)/t24-,25-/m0/s1 |
| InChIKey | NKXUVLXTGUGFCZ-DQEYMECFSA-N |
| XLogP | 5.30 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.01 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|