C28H24ClN3O3S — CID 133158849
4-chloro-3-[5-[3-(4-propan-2-ylphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid (PubChem CID 133158849) has the molecular formula C28H24ClN3O3S and a molecular weight of 518.04 g/mol. Its IUPAC name is 4-chloro-3-[5-[3-(4-propan-2-ylphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[3-(4-propan-2-ylphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 133158849 |
| Molecular Formula | C28H24ClN3O3S |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 4-chloro-3-[5-[3-(4-propan-2-ylphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
| SMILES | CC(C)c1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(-c3cc(C(=O)O)ccc3Cl)o2)cc1 |
| InChI | InChI=1S/C28H24ClN3O3S/c1-16(2)17-6-9-19(10-7-17)32-26(25(31-28(32)36)22-5-3-4-14-30-22)24-13-12-23(35-24)20-15-18(27(33)34)8-11-21(20)29/h3-16,25-26H,1-2H3,(H,31,36)(H,33,34) |
| InChIKey | VPRXJEQVVZUFDD-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|