C28H26ClN3OS — CID 133158850
5-[5-(3-chloro-4-methylphenyl)furan-2-yl]-1-(4-propan-2-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133158850) has the molecular formula C28H26ClN3OS and a molecular weight of 488.06 g/mol. Its IUPAC name is 5-[5-(3-chloro-4-methylphenyl)furan-2-yl]-1-(4-propan-2-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(3-chloro-4-methylphenyl)furan-2-yl]-1-(4-propan-2-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133158850 |
| Molecular Formula | C28H26ClN3OS |
| Molecular Weight | 488.06 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 5-[5-(3-chloro-4-methylphenyl)furan-2-yl]-1-(4-propan-2-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3c3ccc(C(C)C)cc3)o2)cc1Cl |
| InChI | InChI=1S/C28H26ClN3OS/c1-17(2)19-9-11-21(12-10-19)32-27(26(31-28(32)34)23-6-4-5-15-30-23)25-14-13-24(33-25)20-8-7-18(3)22(29)16-20/h4-17,26-27H,1-3H3,(H,31,34) |
| InChIKey | WIIDVGWWAOWQBY-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.06 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|