C28H25Cl2N3O3S — CID 133157269
1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-[5-(3-chloro-4-methylphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157269) has the molecular formula C28H25Cl2N3O3S and a molecular weight of 554.50 g/mol. Its IUPAC name is 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-[5-(3-chloro-4-methylphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-[5-(3-chloro-4-methylphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157269 |
| Molecular Formula | C28H25Cl2N3O3S |
| Molecular Weight | 554.50 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-[5-(3-chloro-4-methylphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COCCOc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(-c3ccc(C)c(Cl)c3)o2)cc1Cl |
| InChI | InChI=1S/C28H25Cl2N3O3S/c1-17-6-7-18(15-20(17)29)23-10-11-25(36-23)27-26(22-5-3-4-12-31-22)32-28(37)33(27)19-8-9-24(21(30)16-19)35-14-13-34-2/h3-12,15-16,26-27H,13-14H2,1-2H3,(H,32,37) |
| InChIKey | FRUHXRBLZNMMTG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.50 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|