C25H20ClN3O2S — CID 100514733
(4R,5S)-1-(3-chloro-4-methoxyphenyl)-5-(5-phenylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100514733) has the molecular formula C25H20ClN3O2S and a molecular weight of 461.97 g/mol. Its IUPAC name is (4R,5S)-1-(3-chloro-4-methoxyphenyl)-5-(5-phenylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(3-chloro-4-methoxyphenyl)-5-(5-phenylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100514733 |
| Molecular Formula | C25H20ClN3O2S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | (4R,5S)-1-(3-chloro-4-methoxyphenyl)-5-(5-phenylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)N[C@@H](c3ccccn3)[C@H]2c2ccc(-c3ccccc3)o2)cc1Cl |
| InChI | InChI=1S/C25H20ClN3O2S/c1-30-21-11-10-17(15-18(21)26)29-24(23(28-25(29)32)19-9-5-6-14-27-19)22-13-12-20(31-22)16-7-3-2-4-8-16/h2-15,23-24H,1H3,(H,28,32)/t23-,24+/m0/s1 |
| InChIKey | NBTOMLWZKURJRM-BJKOFHAPSA-N |
| XLogP | 6.18 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|