C27H22ClN3O4S — CID 100516188
methyl 2-[5-[(4R,5S)-3-(3-chloro-4-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate (PubChem CID 100516188) has the molecular formula C27H22ClN3O4S and a molecular weight of 520.01 g/mol. Its IUPAC name is methyl 2-[5-[(4R,5S)-3-(3-chloro-4-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(4R,5S)-3-(3-chloro-4-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 100516188 |
| Molecular Formula | C27H22ClN3O4S |
| Molecular Weight | 520.01 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | methyl 2-[5-[(4R,5S)-3-(3-chloro-4-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc([C@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(OC)c(Cl)c2)o1 |
| InChI | InChI=1S/C27H22ClN3O4S/c1-33-22-11-10-16(15-19(22)28)31-25(24(30-27(31)36)20-9-5-6-14-29-20)23-13-12-21(35-23)17-7-3-4-8-18(17)26(32)34-2/h3-15,24-25H,1-2H3,(H,30,36)/t24-,25+/m1/s1 |
| InChIKey | PZHOYPWEFNSUTA-RPBOFIJWSA-N |
| XLogP | 5.97 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.01 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|